C15H16BrNO3S — CID 18113807
3-bromo-N-[2-(furan-2-ylmethylsulfanyl)ethyl]-4-methoxybenzamide (PubChem CID 18113807) has the molecular formula C15H16BrNO3S and a molecular weight of 370.27 g/mol. Its IUPAC name is 3-bromo-N-[2-(furan-2-ylmethylsulfanyl)ethyl]-4-methoxybenzamide.
| Compound Name | 3-bromo-N-[2-(furan-2-ylmethylsulfanyl)ethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 18113807 |
| Molecular Formula | C15H16BrNO3S |
| Molecular Weight | 370.27 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | 3-bromo-N-[2-(furan-2-ylmethylsulfanyl)ethyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCSCc2ccco2)cc1Br |
| InChI | InChI=1S/C15H16BrNO3S/c1-19-14-5-4-11(9-13(14)16)15(18)17-6-8-21-10-12-3-2-7-20-12/h2-5,7,9H,6,8,10H2,1H3,(H,17,18) |
| InChIKey | LXYWJDUJPMYYSX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|