C17H20N2O4S2 — CID 18113864
4-(cyclopropylsulfamoyl)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]benzamide (PubChem CID 18113864) has the molecular formula C17H20N2O4S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 4-(cyclopropylsulfamoyl)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]benzamide.
| Compound Name | 4-(cyclopropylsulfamoyl)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]benzamide |
|---|---|
| PubChem CID | 18113864 |
| Molecular Formula | C17H20N2O4S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 4-(cyclopropylsulfamoyl)-N-[2-(furan-2-ylmethylsulfanyl)ethyl]benzamide |
| SMILES | O=C(NCCSCc1ccco1)c1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C17H20N2O4S2/c20-17(18-9-11-24-12-15-2-1-10-23-15)13-3-7-16(8-4-13)25(21,22)19-14-5-6-14/h1-4,7-8,10,14,19H,5-6,9,11-12H2,(H,18,20) |
| InChIKey | CHMPETPXEDDUQG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|