C18H17Cl3OS — CID 161465236
5-[(3-chlorophenyl)methylsulfanyl]-1-(2,6-dichlorophenyl)pentan-2-one (PubChem CID 161465236) has the molecular formula C18H17Cl3OS and a molecular weight of 387.76 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)methylsulfanyl]-1-(2,6-dichlorophenyl)pentan-2-one.
| Compound Name | 5-[(3-chlorophenyl)methylsulfanyl]-1-(2,6-dichlorophenyl)pentan-2-one |
|---|---|
| PubChem CID | 161465236 |
| Molecular Formula | C18H17Cl3OS |
| Molecular Weight | 387.76 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | 5-[(3-chlorophenyl)methylsulfanyl]-1-(2,6-dichlorophenyl)pentan-2-one |
| SMILES | O=C(CCCSCc1cccc(Cl)c1)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H17Cl3OS/c19-14-5-1-4-13(10-14)12-23-9-3-6-15(22)11-16-17(20)7-2-8-18(16)21/h1-2,4-5,7-8,10H,3,6,9,11-12H2 |
| InChIKey | CVWRHKAWGKHWHK-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.76 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|