C27H23N7O3S3 — CID 25043417
3-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]-N-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]propanamide (PubChem CID 25043417) has the molecular formula C27H23N7O3S3 and a molecular weight of 589.73 g/mol. Its IUPAC name is 3-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]-N-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]propanamide.
| Compound Name | 3-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]-N-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]propanamide |
|---|---|
| PubChem CID | 25043417 |
| Molecular Formula | C27H23N7O3S3 |
| Molecular Weight | 589.73 g/mol |
| Exact Mass | 589.10 |
| IUPAC Name | 3-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanyl]-N-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]propanamide |
| SMILES | Cc1nnc(NS(=O)(=O)c2ccc(NC(=O)CCSc3nnc(-c4ccccc4)c(-c4ccccc4)n3)cc2)s1 |
| InChI | InChI=1S/C27H23N7O3S3/c1-18-30-33-27(39-18)34-40(36,37)22-14-12-21(13-15-22)28-23(35)16-17-38-26-29-24(19-8-4-2-5-9-19)25(31-32-26)20-10-6-3-7-11-20/h2-15H,16-17H2,1H3,(H,28,35)(H,33,34) |
| InChIKey | MCLMPPLTJDNMMT-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 139.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.73 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |