C29H27N7O5S3 — CID 25038020
2-[[5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-yl]sulfanyl]-N-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]propanamide (PubChem CID 25038020) has the molecular formula C29H27N7O5S3 and a molecular weight of 649.78 g/mol. Its IUPAC name is 2-[[5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-yl]sulfanyl]-N-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]propanamide.
| Compound Name | 2-[[5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-yl]sulfanyl]-N-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]propanamide |
|---|---|
| PubChem CID | 25038020 |
| Molecular Formula | C29H27N7O5S3 |
| Molecular Weight | 649.78 g/mol |
| Exact Mass | 649.12 |
| IUPAC Name | 2-[[5,6-bis(4-methoxyphenyl)-1,2,4-triazin-3-yl]sulfanyl]-N-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]propanamide |
| SMILES | COc1ccc(-c2nnc(SC(C)C(=O)Nc3ccc(S(=O)(=O)Nc4nnc(C)s4)cc3)nc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H27N7O5S3/c1-17(27(37)30-21-9-15-24(16-10-21)44(38,39)36-29-35-32-18(2)43-29)42-28-31-25(19-5-11-22(40-3)12-6-19)26(33-34-28)20-7-13-23(41-4)14-8-20/h5-17H,1-4H3,(H,30,37)(H,35,36) |
| InChIKey | PEKLETZRYQJTSB-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.78 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |