C21H18N8O3S3 — CID 25035615
N-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)propanamide (PubChem CID 25035615) has the molecular formula C21H18N8O3S3 and a molecular weight of 526.63 g/mol. Its IUPAC name is N-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)propanamide.
| Compound Name | N-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)propanamide |
|---|---|
| PubChem CID | 25035615 |
| Molecular Formula | C21H18N8O3S3 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.07 |
| IUPAC Name | N-[4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)propanamide |
| SMILES | Cc1nnc(NS(=O)(=O)c2ccc(NC(=O)C(C)Sc3nnc4c(n3)[nH]c3ccccc34)cc2)s1 |
| InChI | InChI=1S/C21H18N8O3S3/c1-11(33-20-24-18-17(26-27-20)15-5-3-4-6-16(15)23-18)19(30)22-13-7-9-14(10-8-13)35(31,32)29-21-28-25-12(2)34-21/h3-11H,1-2H3,(H,22,30)(H,28,29)(H,23,24,27) |
| InChIKey | LDZLETRRGPNPKZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 155.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |