C23H16BrN5O3S2 — CID 23889174
3-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 23889174) has the molecular formula C23H16BrN5O3S2 and a molecular weight of 554.45 g/mol. Its IUPAC name is 3-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 3-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 23889174 |
| Molecular Formula | C23H16BrN5O3S2 |
| Molecular Weight | 554.45 g/mol |
| Exact Mass | 552.99 |
| IUPAC Name | 3-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | O=C(CCSc1nnc(-c2ccco2)c(-c2ccco2)n1)Nc1nc(-c2ccc(Br)cc2)cs1 |
| InChI | InChI=1S/C23H16BrN5O3S2/c24-15-7-5-14(6-8-15)16-13-34-22(25-16)26-19(30)9-12-33-23-27-20(17-3-1-10-31-17)21(28-29-23)18-4-2-11-32-18/h1-8,10-11,13H,9,12H2,(H,25,26,30) |
| InChIKey | IOSWEHQIRZKHHW-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.45 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_thio_6_furan(4)', 'substructure': 'N/A'} |
|---|