C18H17N3O2S — CID 2660521
2-(2,5-dimethylphenoxy)-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)acetamide (PubChem CID 2660521) has the molecular formula C18H17N3O2S and a molecular weight of 339.42 g/mol. Its IUPAC name is 2-(2,5-dimethylphenoxy)-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(2,5-dimethylphenoxy)-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 2660521 |
| Molecular Formula | C18H17N3O2S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 2-(2,5-dimethylphenoxy)-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)acetamide |
| SMILES | Cc1ccc(C)c(OCC(=O)Nc2nc(-c3ccccn3)cs2)c1 |
| InChI | InChI=1S/C18H17N3O2S/c1-12-6-7-13(2)16(9-12)23-10-17(22)21-18-20-15(11-24-18)14-5-3-4-8-19-14/h3-9,11H,10H2,1-2H3,(H,20,21,22) |
| InChIKey | YZQIONLAVGEKMS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |