C16H18N2O2S — CID 33301642
N-(4-cyclopropyl-1,3-thiazol-2-yl)-2-(2,5-dimethylphenoxy)acetamide (PubChem CID 33301642) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is N-(4-cyclopropyl-1,3-thiazol-2-yl)-2-(2,5-dimethylphenoxy)acetamide.
| Compound Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-2-(2,5-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 33301642 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-2-(2,5-dimethylphenoxy)acetamide |
| SMILES | Cc1ccc(C)c(OCC(=O)Nc2nc(C3CC3)cs2)c1 |
| InChI | InChI=1S/C16H18N2O2S/c1-10-3-4-11(2)14(7-10)20-8-15(19)18-16-17-13(9-21-16)12-5-6-12/h3-4,7,9,12H,5-6,8H2,1-2H3,(H,17,18,19) |
| InChIKey | CWGNJHHHBKHDPI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |