C25H17N5O3S — CID 17361625
N-(4-methyl-1,3-thiazol-2-yl)-1,3-dioxo-2-(4-phenyldiazenylphenyl)isoindole-5-carboxamide (PubChem CID 17361625) has the molecular formula C25H17N5O3S and a molecular weight of 467.51 g/mol. Its IUPAC name is N-(4-methyl-1,3-thiazol-2-yl)-1,3-dioxo-2-(4-phenyldiazenylphenyl)isoindole-5-carboxamide.
| Compound Name | N-(4-methyl-1,3-thiazol-2-yl)-1,3-dioxo-2-(4-phenyldiazenylphenyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 17361625 |
| Molecular Formula | C25H17N5O3S |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | N-(4-methyl-1,3-thiazol-2-yl)-1,3-dioxo-2-(4-phenyldiazenylphenyl)isoindole-5-carboxamide |
| SMILES | Cc1csc(NC(=O)c2ccc3c(c2)C(=O)N(c2ccc(/N=N/c4ccccc4)cc2)C3=O)n1 |
| InChI | InChI=1S/C25H17N5O3S/c1-15-14-34-25(26-15)27-22(31)16-7-12-20-21(13-16)24(33)30(23(20)32)19-10-8-18(9-11-19)29-28-17-5-3-2-4-6-17/h2-14H,1H3,(H,26,27,31)/b29-28+ |
| InChIKey | RYBOZXFAAPDPJP-ZQHSETAFSA-N |
| XLogP | 5.92 |
| TPSA | 104.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|