C20H15N3O4S — CID 17361614
2-(4-methoxyphenyl)-N-(4-methyl-1,3-thiazol-2-yl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 17361614) has the molecular formula C20H15N3O4S and a molecular weight of 393.42 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-(4-methyl-1,3-thiazol-2-yl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(4-methoxyphenyl)-N-(4-methyl-1,3-thiazol-2-yl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 17361614 |
| Molecular Formula | C20H15N3O4S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-(4-methyl-1,3-thiazol-2-yl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | COc1ccc(N2C(=O)c3ccc(C(=O)Nc4nc(C)cs4)cc3C2=O)cc1 |
| InChI | InChI=1S/C20H15N3O4S/c1-11-10-28-20(21-11)22-17(24)12-3-8-15-16(9-12)19(26)23(18(15)25)13-4-6-14(27-2)7-5-13/h3-10H,1-2H3,(H,21,22,24) |
| InChIKey | VIBRKCHOHLBIKP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|