C19H14N4O3S — CID 17361656
2-(4-methyl-2-pyridinyl)-N-(4-methyl-1,3-thiazol-2-yl)-1,3-dioxoisoindole-5-carboxamide (PubChem CID 17361656) has the molecular formula C19H14N4O3S and a molecular weight of 378.41 g/mol. Its IUPAC name is 2-(4-methyl-2-pyridinyl)-N-(4-methyl-1,3-thiazol-2-yl)-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(4-methyl-2-pyridinyl)-N-(4-methyl-1,3-thiazol-2-yl)-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 17361656 |
| Molecular Formula | C19H14N4O3S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 2-(4-methyl-2-pyridinyl)-N-(4-methyl-1,3-thiazol-2-yl)-1,3-dioxoisoindole-5-carboxamide |
| SMILES | Cc1ccnc(N2C(=O)c3ccc(C(=O)Nc4nc(C)cs4)cc3C2=O)c1 |
| InChI | InChI=1S/C19H14N4O3S/c1-10-5-6-20-15(7-10)23-17(25)13-4-3-12(8-14(13)18(23)26)16(24)22-19-21-11(2)9-27-19/h3-9H,1-2H3,(H,21,22,24) |
| InChIKey | IONSUMMIWPLLQP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|