C21H16FNO5 — CID 7738400
[(1R)-2-oxocyclohexyl] 2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 7738400) has the molecular formula C21H16FNO5 and a molecular weight of 381.36 g/mol. Its IUPAC name is [(1R)-2-oxocyclohexyl] 2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [(1R)-2-oxocyclohexyl] 2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 7738400 |
| Molecular Formula | C21H16FNO5 |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | [(1R)-2-oxocyclohexyl] 2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | O=C(O[C@@H]1CCCCC1=O)c1ccc2c(c1)C(=O)N(c1ccc(F)cc1)C2=O |
| InChI | InChI=1S/C21H16FNO5/c22-13-6-8-14(9-7-13)23-19(25)15-10-5-12(11-16(15)20(23)26)21(27)28-18-4-2-1-3-17(18)24/h5-11,18H,1-4H2/t18-/m1/s1 |
| InChIKey | FQBPGSYDIOGXMN-GOSISDBHSA-N |
| XLogP | 3.29 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|