C25H26FNO4 — CID 23912067
(5-methyl-2-propan-2-ylcyclohexyl) 2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 23912067) has the molecular formula C25H26FNO4 and a molecular weight of 423.48 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 23912067 |
| Molecular Formula | C25H26FNO4 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 2-(4-fluorophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)c2ccc3c(c2)C(=O)N(c2ccc(F)cc2)C3=O)C1 |
| InChI | InChI=1S/C25H26FNO4/c1-14(2)19-10-4-15(3)12-22(19)31-25(30)16-5-11-20-21(13-16)24(29)27(23(20)28)18-8-6-17(26)7-9-18/h5-9,11,13-15,19,22H,4,10,12H2,1-3H3 |
| InChIKey | VUHPNBCZMIIHHL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|