About [(1R)-2-oxocyclohexyl] 3-methoxybenzoate
[(1R)-2-oxocyclohexyl] 3-methoxybenzoate (PubChem CID 40842759) has the molecular formula C14H16O4
and a molecular weight of 248.28 g/mol. Its IUPAC name is [(1R)-2-oxocyclohexyl] 3-methoxybenzoate.
Molecular Properties
| Compound Name | [(1R)-2-oxocyclohexyl] 3-methoxybenzoate |
| PubChem CID | 40842759 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | [(1R)-2-oxocyclohexyl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)O[C@@H]2CCCCC2=O)c1 |
| InChI | InChI=1S/C14H16O4/c1-17-11-6-4-5-10(9-11)14(16)18-13-8-3-2-7-12(13)15/h4-6,9,13H,2-3,7-8H2,1H3/t13-/m1/s1 |
| InChIKey | HVBCOPCCBOWVPA-CYBMUJFWSA-N |
| XLogP | 2.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1R)-2-oxocyclohexyl] 3-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-2-oxocyclohexyl] 3-methoxybenzoate?
The IUPAC name of [(1R)-2-oxocyclohexyl] 3-methoxybenzoate (CID 40842759) is [(1R)-2-oxocyclohexyl] 3-methoxybenzoate.
What is the SMILES notation for [(1R)-2-oxocyclohexyl] 3-methoxybenzoate?
The canonical SMILES for [(1R)-2-oxocyclohexyl] 3-methoxybenzoate is COc1cccc(C(=O)O[C@@H]2CCCCC2=O)c1.
What is the InChIKey of [(1R)-2-oxocyclohexyl] 3-methoxybenzoate?
The InChIKey is HVBCOPCCBOWVPA-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H16O4/c1-17-11-6-4-5-10(9-11)14(16)18-13-8-3-2-7-12(13)15/h4-6,9,13H,2-3,7-8H2,1H3/t13-/m1/s1.
What are the key properties of [(1R)-2-oxocyclohexyl] 3-methoxybenzoate?
[(1R)-2-oxocyclohexyl] 3-methoxybenzoate has a molecular weight of 248.28 g/mol, XLogP of 2.36, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-2-oxocyclohexyl] 3-methoxybenzoate is sourced from PubChem (CID 40842759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).