C17H19NO4 — CID 8725942
[(1R)-2-oxocyclohexyl] 3-(2-oxopyrrolidin-1-yl)benzoate (PubChem CID 8725942) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is [(1R)-2-oxocyclohexyl] 3-(2-oxopyrrolidin-1-yl)benzoate.
| Compound Name | [(1R)-2-oxocyclohexyl] 3-(2-oxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 8725942 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | [(1R)-2-oxocyclohexyl] 3-(2-oxopyrrolidin-1-yl)benzoate |
| SMILES | O=C(O[C@@H]1CCCCC1=O)c1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C17H19NO4/c19-14-7-1-2-8-15(14)22-17(21)12-5-3-6-13(11-12)18-10-4-9-16(18)20/h3,5-6,11,15H,1-2,4,7-10H2/t15-/m1/s1 |
| InChIKey | ZCDSXTGPPJMMEY-OAHLLOKOSA-N |
| XLogP | 2.48 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |