C23H18F2N2O2 — CID 71840635
N,1-bis[(4-fluorophenyl)methyl]-2-oxo-3H-indole-5-carboxamide (PubChem CID 71840635) has the molecular formula C23H18F2N2O2 and a molecular weight of 392.41 g/mol. Its IUPAC name is N,1-bis[(4-fluorophenyl)methyl]-2-oxo-3H-indole-5-carboxamide.
| Compound Name | N,1-bis[(4-fluorophenyl)methyl]-2-oxo-3H-indole-5-carboxamide |
|---|---|
| PubChem CID | 71840635 |
| Molecular Formula | C23H18F2N2O2 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N,1-bis[(4-fluorophenyl)methyl]-2-oxo-3H-indole-5-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1ccc2c(c1)CC(=O)N2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C23H18F2N2O2/c24-19-6-1-15(2-7-19)13-26-23(29)17-5-10-21-18(11-17)12-22(28)27(21)14-16-3-8-20(25)9-4-16/h1-11H,12-14H2,(H,26,29) |
| InChIKey | ZHYHZLWPSAQDIH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |