C22H24FN3O3 — CID 71840637
1-[(4-fluorophenyl)methyl]-N-(2-morpholin-4-ylethyl)-2-oxo-3H-indole-5-carboxamide (PubChem CID 71840637) has the molecular formula C22H24FN3O3 and a molecular weight of 397.45 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-N-(2-morpholin-4-ylethyl)-2-oxo-3H-indole-5-carboxamide.
| Compound Name | 1-[(4-fluorophenyl)methyl]-N-(2-morpholin-4-ylethyl)-2-oxo-3H-indole-5-carboxamide |
|---|---|
| PubChem CID | 71840637 |
| Molecular Formula | C22H24FN3O3 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-N-(2-morpholin-4-ylethyl)-2-oxo-3H-indole-5-carboxamide |
| SMILES | O=C(NCCN1CCOCC1)c1ccc2c(c1)CC(=O)N2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H24FN3O3/c23-19-4-1-16(2-5-19)15-26-20-6-3-17(13-18(20)14-21(26)27)22(28)24-7-8-25-9-11-29-12-10-25/h1-6,13H,7-12,14-15H2,(H,24,28) |
| InChIKey | MFBXBMHKDBBWJM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |