C28H27N3O3S — CID 3653650
3-[4-(2-methoxyphenyl)piperazine-1-carbonyl]-5-prop-2-enylbenzo[b][1,4]benzothiazepin-6-one (PubChem CID 3653650) has the molecular formula C28H27N3O3S and a molecular weight of 485.61 g/mol. Its IUPAC name is 3-[4-(2-methoxyphenyl)piperazine-1-carbonyl]-5-prop-2-enylbenzo[b][1,4]benzothiazepin-6-one.
| Compound Name | 3-[4-(2-methoxyphenyl)piperazine-1-carbonyl]-5-prop-2-enylbenzo[b][1,4]benzothiazepin-6-one |
|---|---|
| PubChem CID | 3653650 |
| Molecular Formula | C28H27N3O3S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 3-[4-(2-methoxyphenyl)piperazine-1-carbonyl]-5-prop-2-enylbenzo[b][1,4]benzothiazepin-6-one |
| SMILES | C=CCN1C(=O)c2ccccc2Sc2ccc(C(=O)N3CCN(c4ccccc4OC)CC3)cc21 |
| InChI | InChI=1S/C28H27N3O3S/c1-3-14-31-23-19-20(12-13-26(23)35-25-11-7-4-8-21(25)28(31)33)27(32)30-17-15-29(16-18-30)22-9-5-6-10-24(22)34-2/h3-13,19H,1,14-18H2,2H3 |
| InChIKey | OILSARNVQBKUPT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|