C26H20ClN3O4 — CID 55805338
2-chloro-N-cyclopropyl-4-[[4-[(1,3-dioxoisoindol-2-yl)methyl]benzoyl]amino]benzamide (PubChem CID 55805338) has the molecular formula C26H20ClN3O4 and a molecular weight of 473.92 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-4-[[4-[(1,3-dioxoisoindol-2-yl)methyl]benzoyl]amino]benzamide.
| Compound Name | 2-chloro-N-cyclopropyl-4-[[4-[(1,3-dioxoisoindol-2-yl)methyl]benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 55805338 |
| Molecular Formula | C26H20ClN3O4 |
| Molecular Weight | 473.92 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | 2-chloro-N-cyclopropyl-4-[[4-[(1,3-dioxoisoindol-2-yl)methyl]benzoyl]amino]benzamide |
| SMILES | O=C(Nc1ccc(C(=O)NC2CC2)c(Cl)c1)c1ccc(CN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C26H20ClN3O4/c27-22-13-18(11-12-21(22)24(32)28-17-9-10-17)29-23(31)16-7-5-15(6-8-16)14-30-25(33)19-3-1-2-4-20(19)26(30)34/h1-8,11-13,17H,9-10,14H2,(H,28,32)(H,29,31) |
| InChIKey | YLGJKJISTIYPRP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.92 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|