C17H12FN3O3 — CID 51180148
N'-[5-(2-fluorophenyl)furan-2-carbonyl]pyridine-3-carbohydrazide (PubChem CID 51180148) has the molecular formula C17H12FN3O3 and a molecular weight of 325.30 g/mol. Its IUPAC name is N'-[5-(2-fluorophenyl)furan-2-carbonyl]pyridine-3-carbohydrazide.
| Compound Name | N'-[5-(2-fluorophenyl)furan-2-carbonyl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 51180148 |
| Molecular Formula | C17H12FN3O3 |
| Molecular Weight | 325.30 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | N'-[5-(2-fluorophenyl)furan-2-carbonyl]pyridine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc(-c2ccccc2F)o1)c1cccnc1 |
| InChI | InChI=1S/C17H12FN3O3/c18-13-6-2-1-5-12(13)14-7-8-15(24-14)17(23)21-20-16(22)11-4-3-9-19-10-11/h1-10H,(H,20,22)(H,21,23) |
| InChIKey | GXDKKRXTVXAEOT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|