C19H20N2O7 — CID 31655781
[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 3-(4-acetylphenoxy)propanoate (PubChem CID 31655781) has the molecular formula C19H20N2O7 and a molecular weight of 388.38 g/mol. Its IUPAC name is [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 3-(4-acetylphenoxy)propanoate.
| Compound Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 3-(4-acetylphenoxy)propanoate |
|---|---|
| PubChem CID | 31655781 |
| Molecular Formula | C19H20N2O7 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 3-(4-acetylphenoxy)propanoate |
| SMILES | CC(=O)c1ccc(OCCC(=O)OCC(=O)NC(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C19H20N2O7/c1-13(22)14-4-6-15(7-5-14)27-10-8-18(24)28-12-17(23)21-19(25)20-11-16-3-2-9-26-16/h2-7,9H,8,10-12H2,1H3,(H2,20,21,23,25) |
| InChIKey | ZYHXHIKEPQVYDM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |