C15H14ClN3O5 — CID 7908965
[2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 3-(furan-2-carbonylamino)propanoate (PubChem CID 7908965) has the molecular formula C15H14ClN3O5 and a molecular weight of 351.75 g/mol. Its IUPAC name is [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 3-(furan-2-carbonylamino)propanoate.
| Compound Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 3-(furan-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 7908965 |
| Molecular Formula | C15H14ClN3O5 |
| Molecular Weight | 351.75 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | [2-[(5-chloro-2-pyridinyl)amino]-2-oxoethyl] 3-(furan-2-carbonylamino)propanoate |
| SMILES | O=C(COC(=O)CCNC(=O)c1ccco1)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C15H14ClN3O5/c16-10-3-4-12(18-8-10)19-13(20)9-24-14(21)5-6-17-15(22)11-2-1-7-23-11/h1-4,7-8H,5-6,9H2,(H,17,22)(H,18,19,20) |
| InChIKey | UOPLCRKYPLFNOK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.75 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |