C19H20N2O7 — CID 7909212
methyl 4-[[[2-[3-(furan-2-carbonylamino)propanoyloxy]acetyl]amino]methyl]benzoate (PubChem CID 7909212) has the molecular formula C19H20N2O7 and a molecular weight of 388.38 g/mol. Its IUPAC name is methyl 4-[[[2-[3-(furan-2-carbonylamino)propanoyloxy]acetyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[2-[3-(furan-2-carbonylamino)propanoyloxy]acetyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 7909212 |
| Molecular Formula | C19H20N2O7 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | methyl 4-[[[2-[3-(furan-2-carbonylamino)propanoyloxy]acetyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)COC(=O)CCNC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C19H20N2O7/c1-26-19(25)14-6-4-13(5-7-14)11-21-16(22)12-28-17(23)8-9-20-18(24)15-3-2-10-27-15/h2-7,10H,8-9,11-12H2,1H3,(H,20,24)(H,21,22) |
| InChIKey | DEGTZBMADKSADZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |