C19H24N4O4 — CID 46456452
N-[3-oxo-3-[[4-(propan-2-ylcarbamoylamino)phenyl]methylamino]propyl]furan-2-carboxamide (PubChem CID 46456452) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is N-[3-oxo-3-[[4-(propan-2-ylcarbamoylamino)phenyl]methylamino]propyl]furan-2-carboxamide.
| Compound Name | N-[3-oxo-3-[[4-(propan-2-ylcarbamoylamino)phenyl]methylamino]propyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 46456452 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | N-[3-oxo-3-[[4-(propan-2-ylcarbamoylamino)phenyl]methylamino]propyl]furan-2-carboxamide |
| SMILES | CC(C)NC(=O)Nc1ccc(CNC(=O)CCNC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C19H24N4O4/c1-13(2)22-19(26)23-15-7-5-14(6-8-15)12-21-17(24)9-10-20-18(25)16-4-3-11-27-16/h3-8,11,13H,9-10,12H2,1-2H3,(H,20,25)(H,21,24)(H2,22,23,26) |
| InChIKey | IQESRRPOYILVDM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |