C18H19ClN2O5 — CID 7909262
[2-[[(1S)-1-(3-chlorophenyl)ethyl]amino]-2-oxoethyl] 3-(furan-2-carbonylamino)propanoate (PubChem CID 7909262) has the molecular formula C18H19ClN2O5 and a molecular weight of 378.81 g/mol. Its IUPAC name is [2-[[(1S)-1-(3-chlorophenyl)ethyl]amino]-2-oxoethyl] 3-(furan-2-carbonylamino)propanoate.
| Compound Name | [2-[[(1S)-1-(3-chlorophenyl)ethyl]amino]-2-oxoethyl] 3-(furan-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 7909262 |
| Molecular Formula | C18H19ClN2O5 |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | [2-[[(1S)-1-(3-chlorophenyl)ethyl]amino]-2-oxoethyl] 3-(furan-2-carbonylamino)propanoate |
| SMILES | C[C@H](NC(=O)COC(=O)CCNC(=O)c1ccco1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H19ClN2O5/c1-12(13-4-2-5-14(19)10-13)21-16(22)11-26-17(23)7-8-20-18(24)15-6-3-9-25-15/h2-6,9-10,12H,7-8,11H2,1H3,(H,20,24)(H,21,22)/t12-/m0/s1 |
| InChIKey | IEHBMESZDYNMNY-LBPRGKRZSA-N |
| XLogP | 2.47 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |