C16H19N3O5 — CID 34282135
N-[4-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]-4-oxobutyl]furan-2-carboxamide (PubChem CID 34282135) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is N-[4-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]-4-oxobutyl]furan-2-carboxamide.
| Compound Name | N-[4-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]-4-oxobutyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 34282135 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | N-[4-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]-4-oxobutyl]furan-2-carboxamide |
| SMILES | Cc1cc(C(=O)NNC(=O)CCCNC(=O)c2ccco2)c(C)o1 |
| InChI | InChI=1S/C16H19N3O5/c1-10-9-12(11(2)24-10)15(21)19-18-14(20)6-3-7-17-16(22)13-5-4-8-23-13/h4-5,8-9H,3,6-7H2,1-2H3,(H,17,22)(H,18,20)(H,19,21) |
| InChIKey | SOOAPPLTUQXIEK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|