C25H20F3N3O3S — CID 157071223
1-[4-methyl-3-(quinolin-5-ylmethylsulfonyl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 157071223) has the molecular formula C25H20F3N3O3S and a molecular weight of 499.51 g/mol. Its IUPAC name is 1-[4-methyl-3-(quinolin-5-ylmethylsulfonyl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-methyl-3-(quinolin-5-ylmethylsulfonyl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 157071223 |
| Molecular Formula | C25H20F3N3O3S |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 1-[4-methyl-3-(quinolin-5-ylmethylsulfonyl)phenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1ccc(NC(=O)Nc2cccc(C(F)(F)F)c2)cc1S(=O)(=O)Cc1cccc2ncccc12 |
| InChI | InChI=1S/C25H20F3N3O3S/c1-16-10-11-20(31-24(32)30-19-7-3-6-18(13-19)25(26,27)28)14-23(16)35(33,34)15-17-5-2-9-22-21(17)8-4-12-29-22/h2-14H,15H2,1H3,(H2,30,31,32) |
| InChIKey | ACLMDYKJKMKVKL-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |