C36H34N4O8S2 — CID 155661533
[4-[[3-[[[4-(3-methylphenyl)sulfonyloxyphenyl]carbamoylamino]methyl]phenyl]methylcarbamoylamino]phenyl] 3-methylbenzenesulfonate (PubChem CID 155661533) has the molecular formula C36H34N4O8S2 and a molecular weight of 714.82 g/mol. Its IUPAC name is [4-[[3-[[[4-(3-methylphenyl)sulfonyloxyphenyl]carbamoylamino]methyl]phenyl]methylcarbamoylamino]phenyl] 3-methylbenzenesulfonate.
| Compound Name | [4-[[3-[[[4-(3-methylphenyl)sulfonyloxyphenyl]carbamoylamino]methyl]phenyl]methylcarbamoylamino]phenyl] 3-methylbenzenesulfonate |
|---|---|
| PubChem CID | 155661533 |
| Molecular Formula | C36H34N4O8S2 |
| Molecular Weight | 714.82 g/mol |
| Exact Mass | 714.18 |
| IUPAC Name | [4-[[3-[[[4-(3-methylphenyl)sulfonyloxyphenyl]carbamoylamino]methyl]phenyl]methylcarbamoylamino]phenyl] 3-methylbenzenesulfonate |
| SMILES | Cc1cccc(S(=O)(=O)Oc2ccc(NC(=O)NCc3cccc(CNC(=O)Nc4ccc(OS(=O)(=O)c5cccc(C)c5)cc4)c3)cc2)c1 |
| InChI | InChI=1S/C36H34N4O8S2/c1-25-6-3-10-33(20-25)49(43,44)47-31-16-12-29(13-17-31)39-35(41)37-23-27-8-5-9-28(22-27)24-38-36(42)40-30-14-18-32(19-15-30)48-50(45,46)34-11-4-7-26(2)21-34/h3-22H,23-24H2,1-2H3,(H2,37,39,41)(H2,38,40,42) |
| InChIKey | OKHZOFYAUDNVBT-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.82 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|