C20H23BrO5S — CID 139559477
[2-(2-bromoacetyl)-5-propoxyphenyl] 2,4,6-trimethylbenzenesulfonate (PubChem CID 139559477) has the molecular formula C20H23BrO5S and a molecular weight of 455.37 g/mol. Its IUPAC name is [2-(2-bromoacetyl)-5-propoxyphenyl] 2,4,6-trimethylbenzenesulfonate.
| Compound Name | [2-(2-bromoacetyl)-5-propoxyphenyl] 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 139559477 |
| Molecular Formula | C20H23BrO5S |
| Molecular Weight | 455.37 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | [2-(2-bromoacetyl)-5-propoxyphenyl] 2,4,6-trimethylbenzenesulfonate |
| SMILES | CCCOc1ccc(C(=O)CBr)c(OS(=O)(=O)c2c(C)cc(C)cc2C)c1 |
| InChI | InChI=1S/C20H23BrO5S/c1-5-8-25-16-6-7-17(18(22)12-21)19(11-16)26-27(23,24)20-14(3)9-13(2)10-15(20)4/h6-7,9-11H,5,8,12H2,1-4H3 |
| InChIKey | JTGQIQHCSQVKBO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.37 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|