C21H25FN2O5 — CID 36737398
2-[(2R)-2-(4-fluorophenyl)morpholin-4-yl]-N-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 36737398) has the molecular formula C21H25FN2O5 and a molecular weight of 404.44 g/mol. Its IUPAC name is 2-[(2R)-2-(4-fluorophenyl)morpholin-4-yl]-N-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | 2-[(2R)-2-(4-fluorophenyl)morpholin-4-yl]-N-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 36737398 |
| Molecular Formula | C21H25FN2O5 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 2-[(2R)-2-(4-fluorophenyl)morpholin-4-yl]-N-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(NC(=O)CN2CCO[C@H](c3ccc(F)cc3)C2)cc(OC)c1OC |
| InChI | InChI=1S/C21H25FN2O5/c1-26-17-10-16(11-18(27-2)21(17)28-3)23-20(25)13-24-8-9-29-19(12-24)14-4-6-15(22)7-5-14/h4-7,10-11,19H,8-9,12-13H2,1-3H3,(H,23,25)/t19-/m0/s1 |
| InChIKey | GIEQRKQMGMBBQU-IBGZPJMESA-N |
| XLogP | 2.86 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |