C22H23FN2O3 — CID 110218665
4-[(2,3-dimethoxyphenyl)methyl]-2-(6-fluoroisoquinolin-3-yl)morpholine (PubChem CID 110218665) has the molecular formula C22H23FN2O3 and a molecular weight of 382.44 g/mol. Its IUPAC name is 4-[(2,3-dimethoxyphenyl)methyl]-2-(6-fluoroisoquinolin-3-yl)morpholine.
| Compound Name | 4-[(2,3-dimethoxyphenyl)methyl]-2-(6-fluoroisoquinolin-3-yl)morpholine |
|---|---|
| PubChem CID | 110218665 |
| Molecular Formula | C22H23FN2O3 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 4-[(2,3-dimethoxyphenyl)methyl]-2-(6-fluoroisoquinolin-3-yl)morpholine |
| SMILES | COc1cccc(CN2CCOC(c3cc4cc(F)ccc4cn3)C2)c1OC |
| InChI | InChI=1S/C22H23FN2O3/c1-26-20-5-3-4-16(22(20)27-2)13-25-8-9-28-21(14-25)19-11-17-10-18(23)7-6-15(17)12-24-19/h3-7,10-12,21H,8-9,13-14H2,1-2H3 |
| InChIKey | IKIFXCVIPYVSHE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |