C25H24N4O2 — CID 127251047
2-[6-(4-methoxyphenyl)pyrazin-2-yl]-4-(quinolin-5-ylmethyl)morpholine (PubChem CID 127251047) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 2-[6-(4-methoxyphenyl)pyrazin-2-yl]-4-(quinolin-5-ylmethyl)morpholine.
| Compound Name | 2-[6-(4-methoxyphenyl)pyrazin-2-yl]-4-(quinolin-5-ylmethyl)morpholine |
|---|---|
| PubChem CID | 127251047 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 2-[6-(4-methoxyphenyl)pyrazin-2-yl]-4-(quinolin-5-ylmethyl)morpholine |
| SMILES | COc1ccc(-c2cncc(C3CN(Cc4cccc5ncccc45)CCO3)n2)cc1 |
| InChI | InChI=1S/C25H24N4O2/c1-30-20-9-7-18(8-10-20)23-14-26-15-24(28-23)25-17-29(12-13-31-25)16-19-4-2-6-22-21(19)5-3-11-27-22/h2-11,14-15,25H,12-13,16-17H2,1H3 |
| InChIKey | JHCPWAVZJNFOQE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |