C22H21N7O — CID 124996475
N-pyrimidin-2-yl-6-[(2R)-4-(quinolin-5-ylmethyl)morpholin-2-yl]pyrazin-2-amine (PubChem CID 124996475) has the molecular formula C22H21N7O and a molecular weight of 399.46 g/mol. Its IUPAC name is N-pyrimidin-2-yl-6-[(2R)-4-(quinolin-5-ylmethyl)morpholin-2-yl]pyrazin-2-amine.
| Compound Name | N-pyrimidin-2-yl-6-[(2R)-4-(quinolin-5-ylmethyl)morpholin-2-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 124996475 |
| Molecular Formula | C22H21N7O |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | N-pyrimidin-2-yl-6-[(2R)-4-(quinolin-5-ylmethyl)morpholin-2-yl]pyrazin-2-amine |
| SMILES | c1cnc(Nc2cncc([C@H]3CN(Cc4cccc5ncccc45)CCO3)n2)nc1 |
| InChI | InChI=1S/C22H21N7O/c1-4-16(17-5-2-7-24-18(17)6-1)14-29-10-11-30-20(15-29)19-12-23-13-21(27-19)28-22-25-8-3-9-26-22/h1-9,12-13,20H,10-11,14-15H2,(H,25,26,27,28)/t20-/m1/s1 |
| InChIKey | QTGOKTNERRWRFS-HXUWFJFHSA-N |
| XLogP | 3.13 |
| TPSA | 88.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |