C18H17ClN6O3S — CID 124996771
6-[(2R)-4-(2-chlorophenyl)sulfonylmorpholin-2-yl]-N-pyrimidin-2-ylpyrazin-2-amine (PubChem CID 124996771) has the molecular formula C18H17ClN6O3S and a molecular weight of 432.89 g/mol. Its IUPAC name is 6-[(2R)-4-(2-chlorophenyl)sulfonylmorpholin-2-yl]-N-pyrimidin-2-ylpyrazin-2-amine.
| Compound Name | 6-[(2R)-4-(2-chlorophenyl)sulfonylmorpholin-2-yl]-N-pyrimidin-2-ylpyrazin-2-amine |
|---|---|
| PubChem CID | 124996771 |
| Molecular Formula | C18H17ClN6O3S |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 6-[(2R)-4-(2-chlorophenyl)sulfonylmorpholin-2-yl]-N-pyrimidin-2-ylpyrazin-2-amine |
| SMILES | O=S(=O)(c1ccccc1Cl)N1CCO[C@@H](c2cncc(Nc3ncccn3)n2)C1 |
| InChI | InChI=1S/C18H17ClN6O3S/c19-13-4-1-2-5-16(13)29(26,27)25-8-9-28-15(12-25)14-10-20-11-17(23-14)24-18-21-6-3-7-22-18/h1-7,10-11,15H,8-9,12H2,(H,21,22,23,24)/t15-/m1/s1 |
| InChIKey | QVPPAGATHHJHBI-OAHLLOKOSA-N |
| XLogP | 2.43 |
| TPSA | 110.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |