C20H20ClN5O3S — CID 110093032
N-[6-[4-[(2-chlorophenyl)methylsulfonyl]morpholin-2-yl]-2-pyridinyl]pyrazin-2-amine (PubChem CID 110093032) has the molecular formula C20H20ClN5O3S and a molecular weight of 445.93 g/mol. Its IUPAC name is N-[6-[4-[(2-chlorophenyl)methylsulfonyl]morpholin-2-yl]-2-pyridinyl]pyrazin-2-amine.
| Compound Name | N-[6-[4-[(2-chlorophenyl)methylsulfonyl]morpholin-2-yl]-2-pyridinyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 110093032 |
| Molecular Formula | C20H20ClN5O3S |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | N-[6-[4-[(2-chlorophenyl)methylsulfonyl]morpholin-2-yl]-2-pyridinyl]pyrazin-2-amine |
| SMILES | O=S(=O)(Cc1ccccc1Cl)N1CCOC(c2cccc(Nc3cnccn3)n2)C1 |
| InChI | InChI=1S/C20H20ClN5O3S/c21-16-5-2-1-4-15(16)14-30(27,28)26-10-11-29-18(13-26)17-6-3-7-19(24-17)25-20-12-22-8-9-23-20/h1-9,12,18H,10-11,13-14H2,(H,23,24,25) |
| InChIKey | RBLUIIGNSPMMCZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |