C19H18ClN5O3S — CID 124974476
N-[6-[(2R)-4-(2-chlorophenyl)sulfonylmorpholin-2-yl]-2-pyridinyl]pyrazin-2-amine (PubChem CID 124974476) has the molecular formula C19H18ClN5O3S and a molecular weight of 431.91 g/mol. Its IUPAC name is N-[6-[(2R)-4-(2-chlorophenyl)sulfonylmorpholin-2-yl]-2-pyridinyl]pyrazin-2-amine.
| Compound Name | N-[6-[(2R)-4-(2-chlorophenyl)sulfonylmorpholin-2-yl]-2-pyridinyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 124974476 |
| Molecular Formula | C19H18ClN5O3S |
| Molecular Weight | 431.91 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | N-[6-[(2R)-4-(2-chlorophenyl)sulfonylmorpholin-2-yl]-2-pyridinyl]pyrazin-2-amine |
| SMILES | O=S(=O)(c1ccccc1Cl)N1CCO[C@@H](c2cccc(Nc3cnccn3)n2)C1 |
| InChI | InChI=1S/C19H18ClN5O3S/c20-14-4-1-2-6-17(14)29(26,27)25-10-11-28-16(13-25)15-5-3-7-18(23-15)24-19-12-21-8-9-22-19/h1-9,12,16H,10-11,13H2,(H,22,23,24)/t16-/m1/s1 |
| InChIKey | KQYYTTCFJYMZHK-MRXNPFEDSA-N |
| XLogP | 3.03 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.91 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |