C21H18N4O2S — CID 97002830
4-methyl-N-[(E)-1-(2-oxo-1,3-dihydroindol-5-yl)ethylideneamino]-2-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 97002830) has the molecular formula C21H18N4O2S and a molecular weight of 390.47 g/mol. Its IUPAC name is 4-methyl-N-[(E)-1-(2-oxo-1,3-dihydroindol-5-yl)ethylideneamino]-2-phenyl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-N-[(E)-1-(2-oxo-1,3-dihydroindol-5-yl)ethylideneamino]-2-phenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 97002830 |
| Molecular Formula | C21H18N4O2S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 4-methyl-N-[(E)-1-(2-oxo-1,3-dihydroindol-5-yl)ethylideneamino]-2-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | C/C(=N\NC(=O)c1sc(-c2ccccc2)nc1C)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C21H18N4O2S/c1-12(15-8-9-17-16(10-15)11-18(26)23-17)24-25-20(27)19-13(2)22-21(28-19)14-6-4-3-5-7-14/h3-10H,11H2,1-2H3,(H,23,26)(H,25,27)/b24-12+ |
| InChIKey | LMMSYENNOXSMFU-WYMPLXKRSA-N |
| XLogP | 3.77 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|