C17H15N3O3 — CID 95976036
2-[(2E)-2-[1-(2-oxo-1,3-dihydroindol-5-yl)ethylidene]hydrazinyl]benzoic acid (PubChem CID 95976036) has the molecular formula C17H15N3O3 and a molecular weight of 309.33 g/mol. Its IUPAC name is 2-[(2E)-2-[1-(2-oxo-1,3-dihydroindol-5-yl)ethylidene]hydrazinyl]benzoic acid.
| Compound Name | 2-[(2E)-2-[1-(2-oxo-1,3-dihydroindol-5-yl)ethylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 95976036 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-[(2E)-2-[1-(2-oxo-1,3-dihydroindol-5-yl)ethylidene]hydrazinyl]benzoic acid |
| SMILES | C/C(=N\Nc1ccccc1C(=O)O)c1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C17H15N3O3/c1-10(11-6-7-14-12(8-11)9-16(21)18-14)19-20-15-5-3-2-4-13(15)17(22)23/h2-8,20H,9H2,1H3,(H,18,21)(H,22,23)/b19-10+ |
| InChIKey | JMQSFFSSKZGHMJ-VXLYETTFSA-N |
| XLogP | 2.72 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_acid_A(19)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|