C7H10N4O3S — CID 112674174
2-amino-N-(2-amino-2-oxoethoxy)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 112674174) has the molecular formula C7H10N4O3S and a molecular weight of 230.25 g/mol. Its IUPAC name is 2-amino-N-(2-amino-2-oxoethoxy)-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-N-(2-amino-2-oxoethoxy)-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 112674174 |
| Molecular Formula | C7H10N4O3S |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 2-amino-N-(2-amino-2-oxoethoxy)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(N)sc1C(=O)NOCC(N)=O |
| InChI | InChI=1S/C7H10N4O3S/c1-3-5(15-7(9)10-3)6(13)11-14-2-4(8)12/h2H2,1H3,(H2,8,12)(H2,9,10)(H,11,13) |
| InChIKey | SJCZNGSOGUGTSV-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|