C9H15N3O2S — CID 62794778
2-amino-N-(2-ethoxyethyl)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 62794778) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is 2-amino-N-(2-ethoxyethyl)-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-N-(2-ethoxyethyl)-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 62794778 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-amino-N-(2-ethoxyethyl)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CCOCCNC(=O)c1sc(N)nc1C |
| InChI | InChI=1S/C9H15N3O2S/c1-3-14-5-4-11-8(13)7-6(2)12-9(10)15-7/h3-5H2,1-2H3,(H2,10,12)(H,11,13) |
| InChIKey | VMGDVXNENJEMIX-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|