C10H15N3OS2 — CID 104872441
2-amino-4-methyl-N-(2-prop-2-enylsulfanylethyl)-1,3-thiazole-5-carboxamide (PubChem CID 104872441) has the molecular formula C10H15N3OS2 and a molecular weight of 257.38 g/mol. Its IUPAC name is 2-amino-4-methyl-N-(2-prop-2-enylsulfanylethyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-4-methyl-N-(2-prop-2-enylsulfanylethyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 104872441 |
| Molecular Formula | C10H15N3OS2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 2-amino-4-methyl-N-(2-prop-2-enylsulfanylethyl)-1,3-thiazole-5-carboxamide |
| SMILES | C=CCSCCNC(=O)c1sc(N)nc1C |
| InChI | InChI=1S/C10H15N3OS2/c1-3-5-15-6-4-12-9(14)8-7(2)13-10(11)16-8/h3H,1,4-6H2,2H3,(H2,11,13)(H,12,14) |
| InChIKey | JYHLTAZGKAJFLX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|