C14H15FN2OS2 — CID 106433548
3-amino-4-fluoro-N-(2-prop-2-enylsulfanylethyl)-1-benzothiophene-2-carboxamide (PubChem CID 106433548) has the molecular formula C14H15FN2OS2 and a molecular weight of 310.42 g/mol. Its IUPAC name is 3-amino-4-fluoro-N-(2-prop-2-enylsulfanylethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-4-fluoro-N-(2-prop-2-enylsulfanylethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 106433548 |
| Molecular Formula | C14H15FN2OS2 |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 3-amino-4-fluoro-N-(2-prop-2-enylsulfanylethyl)-1-benzothiophene-2-carboxamide |
| SMILES | C=CCSCCNC(=O)c1sc2cccc(F)c2c1N |
| InChI | InChI=1S/C14H15FN2OS2/c1-2-7-19-8-6-17-14(18)13-12(16)11-9(15)4-3-5-10(11)20-13/h2-5H,1,6-8,16H2,(H,17,18) |
| InChIKey | VOKKLIICRPJDRG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|