C15H18FN3OS — CID 79517609
3-amino-N-[2-[cyclopropyl(methyl)amino]ethyl]-4-fluoro-1-benzothiophene-2-carboxamide (PubChem CID 79517609) has the molecular formula C15H18FN3OS and a molecular weight of 307.39 g/mol. Its IUPAC name is 3-amino-N-[2-[cyclopropyl(methyl)amino]ethyl]-4-fluoro-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-N-[2-[cyclopropyl(methyl)amino]ethyl]-4-fluoro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 79517609 |
| Molecular Formula | C15H18FN3OS |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 3-amino-N-[2-[cyclopropyl(methyl)amino]ethyl]-4-fluoro-1-benzothiophene-2-carboxamide |
| SMILES | CN(CCNC(=O)c1sc2cccc(F)c2c1N)C1CC1 |
| InChI | InChI=1S/C15H18FN3OS/c1-19(9-5-6-9)8-7-18-15(20)14-13(17)12-10(16)3-2-4-11(12)21-14/h2-4,9H,5-8,17H2,1H3,(H,18,20) |
| InChIKey | BPRYHOMQRNXINL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |