C15H18BrN3OS — CID 114907933
3-amino-6-bromo-N-[2-[cyclopropyl(methyl)amino]ethyl]-1-benzothiophene-2-carboxamide (PubChem CID 114907933) has the molecular formula C15H18BrN3OS and a molecular weight of 368.30 g/mol. Its IUPAC name is 3-amino-6-bromo-N-[2-[cyclopropyl(methyl)amino]ethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-6-bromo-N-[2-[cyclopropyl(methyl)amino]ethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 114907933 |
| Molecular Formula | C15H18BrN3OS |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 3-amino-6-bromo-N-[2-[cyclopropyl(methyl)amino]ethyl]-1-benzothiophene-2-carboxamide |
| SMILES | CN(CCNC(=O)c1sc2cc(Br)ccc2c1N)C1CC1 |
| InChI | InChI=1S/C15H18BrN3OS/c1-19(10-3-4-10)7-6-18-15(20)14-13(17)11-5-2-9(16)8-12(11)21-14/h2,5,8,10H,3-4,6-7,17H2,1H3,(H,18,20) |
| InChIKey | MLNOCQVOZILNIY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |