C12H13BrN2OS2 — CID 114907967
3-amino-6-bromo-N-(2-methylsulfanylethyl)-1-benzothiophene-2-carboxamide (PubChem CID 114907967) has the molecular formula C12H13BrN2OS2 and a molecular weight of 345.29 g/mol. Its IUPAC name is 3-amino-6-bromo-N-(2-methylsulfanylethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-6-bromo-N-(2-methylsulfanylethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 114907967 |
| Molecular Formula | C12H13BrN2OS2 |
| Molecular Weight | 345.29 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | 3-amino-6-bromo-N-(2-methylsulfanylethyl)-1-benzothiophene-2-carboxamide |
| SMILES | CSCCNC(=O)c1sc2cc(Br)ccc2c1N |
| InChI | InChI=1S/C12H13BrN2OS2/c1-17-5-4-15-12(16)11-10(14)8-3-2-7(13)6-9(8)18-11/h2-3,6H,4-5,14H2,1H3,(H,15,16) |
| InChIKey | UAEGKNPGUPJVCE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|