C11H10BrN3O2S — CID 114907674
3-amino-N-(2-amino-2-oxoethyl)-6-bromo-1-benzothiophene-2-carboxamide (PubChem CID 114907674) has the molecular formula C11H10BrN3O2S and a molecular weight of 328.19 g/mol. Its IUPAC name is 3-amino-N-(2-amino-2-oxoethyl)-6-bromo-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-N-(2-amino-2-oxoethyl)-6-bromo-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 114907674 |
| Molecular Formula | C11H10BrN3O2S |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | 3-amino-N-(2-amino-2-oxoethyl)-6-bromo-1-benzothiophene-2-carboxamide |
| SMILES | NC(=O)CNC(=O)c1sc2cc(Br)ccc2c1N |
| InChI | InChI=1S/C11H10BrN3O2S/c12-5-1-2-6-7(3-5)18-10(9(6)14)11(17)15-4-8(13)16/h1-3H,4,14H2,(H2,13,16)(H,15,17) |
| InChIKey | GFHLTIXBNCJSBU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |