C12H14BrN3O3S2 — CID 106342970
3-amino-6-bromo-N-[2-(methylsulfamoyl)ethyl]-1-benzothiophene-2-carboxamide (PubChem CID 106342970) has the molecular formula C12H14BrN3O3S2 and a molecular weight of 392.30 g/mol. Its IUPAC name is 3-amino-6-bromo-N-[2-(methylsulfamoyl)ethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-6-bromo-N-[2-(methylsulfamoyl)ethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 106342970 |
| Molecular Formula | C12H14BrN3O3S2 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 390.97 |
| IUPAC Name | 3-amino-6-bromo-N-[2-(methylsulfamoyl)ethyl]-1-benzothiophene-2-carboxamide |
| SMILES | CNS(=O)(=O)CCNC(=O)c1sc2cc(Br)ccc2c1N |
| InChI | InChI=1S/C12H14BrN3O3S2/c1-15-21(18,19)5-4-16-12(17)11-10(14)8-3-2-7(13)6-9(8)20-11/h2-3,6,15H,4-5,14H2,1H3,(H,16,17) |
| InChIKey | UOVSVJRYVDAJJT-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |