C15H17BrN2OS2 — CID 114908042
3-amino-6-bromo-N-[(2-methylthiolan-2-yl)methyl]-1-benzothiophene-2-carboxamide (PubChem CID 114908042) has the molecular formula C15H17BrN2OS2 and a molecular weight of 385.35 g/mol. Its IUPAC name is 3-amino-6-bromo-N-[(2-methylthiolan-2-yl)methyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-6-bromo-N-[(2-methylthiolan-2-yl)methyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 114908042 |
| Molecular Formula | C15H17BrN2OS2 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 384.00 |
| IUPAC Name | 3-amino-6-bromo-N-[(2-methylthiolan-2-yl)methyl]-1-benzothiophene-2-carboxamide |
| SMILES | CC1(CNC(=O)c2sc3cc(Br)ccc3c2N)CCCS1 |
| InChI | InChI=1S/C15H17BrN2OS2/c1-15(5-2-6-20-15)8-18-14(19)13-12(17)10-4-3-9(16)7-11(10)21-13/h3-4,7H,2,5-6,8,17H2,1H3,(H,18,19) |
| InChIKey | SEPYJQXZYBTRMJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |