C13H17N3O3S2 — CID 106342964
3-amino-7-methyl-N-[2-(methylsulfamoyl)ethyl]-1-benzothiophene-2-carboxamide (PubChem CID 106342964) has the molecular formula C13H17N3O3S2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 3-amino-7-methyl-N-[2-(methylsulfamoyl)ethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-7-methyl-N-[2-(methylsulfamoyl)ethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 106342964 |
| Molecular Formula | C13H17N3O3S2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 3-amino-7-methyl-N-[2-(methylsulfamoyl)ethyl]-1-benzothiophene-2-carboxamide |
| SMILES | CNS(=O)(=O)CCNC(=O)c1sc2c(C)cccc2c1N |
| InChI | InChI=1S/C13H17N3O3S2/c1-8-4-3-5-9-10(14)12(20-11(8)9)13(17)16-6-7-21(18,19)15-2/h3-5,15H,6-7,14H2,1-2H3,(H,16,17) |
| InChIKey | BCDOUWBGXVGHDR-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |